Structure of PDB 3ufs Chain B Binding Site BS05 |
|
|
Ligand ID | HW6 |
InChI | InChI=1S/C22H29ClFN3O/c1-15-7-20(27-22(25)8-15)11-17-13-26-14-21(17)28-6-4-2-3-5-16-9-18(23)12-19(24)10-16/h7-10,12,17,21,26H,2-6,11,13-14H2,1H3,(H2,25,27)/t17-,21+/m1/s1 |
InChIKey | MZDDSPGKIFAODF-UTKZUKDTSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | Cc1cc(nc(c1)N)CC2CNCC2OCCCCCc3cc(cc(c3)Cl)F | OpenEye OEToolkits 1.7.6 | Cc1cc(nc(c1)N)C[C@@H]2CNC[C@@H]2OCCCCCc3cc(cc(c3)Cl)F | CACTVS 3.370 | Cc1cc(N)nc(C[C@@H]2CNC[C@@H]2OCCCCCc3cc(F)cc(Cl)c3)c1 | ACDLabs 12.01 | Fc1cc(cc(Cl)c1)CCCCCOC2C(CNC2)Cc3nc(N)cc(c3)C | CACTVS 3.370 | Cc1cc(N)nc(C[CH]2CNC[CH]2OCCCCCc3cc(F)cc(Cl)c3)c1 |
|
Formula | C22 H29 Cl F N3 O |
Name | 6-{[(3R,4R)-4-{[5-(3-chloro-5-fluorophenyl)pentyl]oxy}pyrrolidin-3-yl]methyl}-4-methylpyridin-2-amine |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095921089
|
PDB chain | 3ufs Chain B Residue 800
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|