Structure of PDB 1dd7 Chain A Binding Site BS03 |
|
|
Ligand ID | 1PM |
InChI | InChI=1S/C23H25N7O5/c1-33-23(32)28-8-9-30(20-4-5-25-22(27-20)29-7-6-24-14-29)17(13-28)11-21(31)26-12-16-2-3-18-19(10-16)35-15-34-18/h2-7,10,14,17H,8-9,11-13,15H2,1H3,(H,26,31)/t17-/m0/s1 |
InChIKey | NVYMEDQKBQMAKF-KRWDZBQOSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.352 | COC(=O)N1CCN([CH](C1)CC(=O)NCc2ccc3OCOc3c2)c4ccnc(n4)n5ccnc5 | CACTVS 3.352 | COC(=O)N1CCN([C@H](C1)CC(=O)NCc2ccc3OCOc3c2)c4ccnc(n4)n5ccnc5 | OpenEye OEToolkits 1.6.1 | COC(=O)N1CCN(C(C1)CC(=O)NCc2ccc3c(c2)OCO3)c4ccnc(n4)n5ccnc5 | OpenEye OEToolkits 1.6.1 | COC(=O)N1CCN([C@H](C1)CC(=O)NCc2ccc3c(c2)OCO3)c4ccnc(n4)n5ccnc5 |
|
Formula | C23 H25 N7 O5 |
Name | methyl (3S)-3-{2-[(1,3-benzodioxol-5-ylmethyl)amino]-2-oxoethyl}-4-[2-(1H-imidazol-1-yl)pyrimidin-4-yl]piperazine-1-carboxylate |
ChEMBL | CHEMBL385324 |
DrugBank | |
ZINC | ZINC000029332358
|
PDB chain | 1dd7 Chain A Residue 601
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
C194 R197 W366 |
Catalytic site (residue number reindexed from 1) |
C81 R84 W240 |
Enzyme Commision number |
1.14.13.39: nitric-oxide synthase (NADPH). |
|
|
|