Structure of PDB 6f8u Chain B Binding Site BS02 |
|
|
Ligand ID | CZQ |
InChI | InChI=1S/C21H28F2N2O5/c1-14-11-25(12-15(2)28-14)20(26)13-27-24-10-16-7-8-18(30-21(22)23)19(9-16)29-17-5-3-4-6-17/h7-10,14-15,17,21H,3-6,11-13H2,1-2H3/b24-10+/t14-,15-/m1/s1 |
InChIKey | YRGXPDDUADZCCU-BAMVQPFASA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | CC1CN(CC(O1)C)C(=O)CON=Cc2ccc(c(c2)OC3CCCC3)OC(F)F | CACTVS 3.385 | C[CH]1CN(C[CH](C)O1)C(=O)CON=Cc2ccc(OC(F)F)c(OC3CCCC3)c2 | OpenEye OEToolkits 2.0.6 | C[C@@H]1CN(C[C@H](O1)C)C(=O)CO/N=C/c2ccc(c(c2)OC3CCCC3)OC(F)F | CACTVS 3.385 | C[C@@H]1CN(C[C@@H](C)O1)C(=O)CO/N=C/c2ccc(OC(F)F)c(OC3CCCC3)c2 |
|
Formula | C21 H28 F2 N2 O5 |
Name | 2-[(~{E})-[4-[bis(fluoranyl)methoxy]-3-cyclopentyloxy-phenyl]methylideneamino]oxy-1-[(2~{R},6~{R})-2,6-dimethylmorpholin-4-yl]ethanone |
ChEMBL | |
DrugBank | |
ZINC | ZINC000473136172
|
PDB chain | 6f8u Chain B Residue 603
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.1.4.53: 3',5'-cyclic-AMP phosphodiesterase. |
|
|
|