Structure of PDB 3fpd Chain B Binding Site BS02 |
|
|
Ligand ID | Q4A |
InChI | InChI=1S/C28H38N6O2/c1-32-12-7-13-34(17-16-32)28-30-24-19-26(36-3)25(35-2)18-23(24)27(31-28)29-22-10-14-33(15-11-22)20-21-8-5-4-6-9-21/h4-6,8-9,18-19,22H,7,10-17,20H2,1-3H3,(H,29,30,31) |
InChIKey | OSXFATOLZGZLSK-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | COc1cc2nc(nc(NC3CCN(CC3)Cc4ccccc4)c2cc1OC)N5CCCN(C)CC5 | OpenEye OEToolkits 1.5.0 | C[N@@]1CCCN(CC1)c2nc3cc(c(cc3c(n2)NC4CCN(CC4)Cc5ccccc5)OC)OC | ACDLabs 10.04 | O(c5cc1c(nc(nc1NC3CCN(Cc2ccccc2)CC3)N4CCCN(C)CC4)cc5OC)C | OpenEye OEToolkits 1.5.0 | CN1CCCN(CC1)c2nc3cc(c(cc3c(n2)NC4CCN(CC4)Cc5ccccc5)OC)OC |
|
Formula | C28 H38 N6 O2 |
Name | N-(1-benzylpiperidin-4-yl)-6,7-dimethoxy-2-(4-methyl-1,4-diazepan-1-yl)quinazolin-4-amine |
ChEMBL | CHEMBL569864 |
DrugBank | |
ZINC | ZINC000036382102
|
PDB chain | 3fpd Chain B Residue 2
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
Y1124 Y1211 |
Catalytic site (residue number reindexed from 1) |
Y149 Y236 |
Enzyme Commision number |
2.1.1.- 2.1.1.367: [histone H3]-lysine(9) N-methyltransferase. |
|
|
|