Structure of PDB 4ddr Chain A Binding Site BS02 |
|
|
Ligand ID | MMV |
InChI | InChI=1S/C18H24N4O4/c1-2-13-16(17(19)22-18(20)21-13)26-11-5-10-25-14-7-4-3-6-12(14)8-9-15(23)24/h3-4,6-7H,2,5,8-11H2,1H3,(H,23,24)(H4,19,20,21,22) |
InChIKey | VDGXZSSDCDPCRF-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C(O)CCc2ccccc2OCCCOc1c(nc(nc1CC)N)N | CACTVS 3.370 | CCc1nc(N)nc(N)c1OCCCOc2ccccc2CCC(O)=O | OpenEye OEToolkits 1.7.6 | CCc1c(c(nc(n1)N)N)OCCCOc2ccccc2CCC(=O)O |
|
Formula | C18 H24 N4 O4 |
Name | 3-(2-{3-[(2,4-diamino-6-ethylpyrimidin-5-yl)oxy]propoxy}phenyl)propanoic acid |
ChEMBL | CHEMBL3040038 |
DrugBank | |
ZINC | ZINC000095921197
|
PDB chain | 4ddr Chain A Residue 202
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
L22 E30 |
Catalytic site (residue number reindexed from 1) |
L22 E30 |
Enzyme Commision number |
1.5.1.3: dihydrofolate reductase. |
|
|
|