Structure of PDB 6ueg Chain C Binding Site BS01 |
|
|
Ligand ID | Q5G |
InChI | InChI=1S/C14H16N2O5S/c15-14(20)11-7-16(9-3-1-2-4-10(9)21-11)12(17)8-22-6-5-13(18)19/h1-4,11H,5-8H2,(H2,15,20)(H,18,19)/t11-/m1/s1 |
InChIKey | SDNYVGUVTOZEQL-LLVKDONJSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | c1ccc2c(c1)N(CC(O2)C(=O)N)C(=O)CSCCC(=O)O | ACDLabs 12.01 | C(=O)(O)CCSCC(N2c1c(cccc1)OC(C2)C(N)=O)=O | CACTVS 3.385 | NC(=O)[CH]1CN(C(=O)CSCCC(O)=O)c2ccccc2O1 | CACTVS 3.385 | NC(=O)[C@H]1CN(C(=O)CSCCC(O)=O)c2ccccc2O1 | OpenEye OEToolkits 2.0.7 | c1ccc2c(c1)N(C[C@@H](O2)C(=O)N)C(=O)CSCCC(=O)O |
|
Formula | C14 H16 N2 O5 S |
Name | 3-({2-[(2R)-2-carbamoyl-2,3-dihydro-4H-1,4-benzoxazin-4-yl]-2-oxoethyl}sulfanyl)propanoic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000025105584
|
PDB chain | 6ueg Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
H121 D122 G139 |
Catalytic site (residue number reindexed from 1) |
H119 D120 G137 |
Enzyme Commision number |
2.3.1.129: acyl-[acyl-carrier-protein]--UDP-N-acetylglucosamine O-acyltransferase. |
|
|
|