Structure of PDB 6od6 Chain B Binding Site BS01 |
|
|
Ligand ID | M7D |
InChI | InChI=1S/C21H17FN6O/c1-21(12-28-8-2-3-18(28)19(24)27-21)15-9-14(5-6-16(15)22)26-20(29)17-7-4-13(10-23)11-25-17/h2-9,11H,12H2,1H3,(H2,24,27)(H,26,29)/t21-/m0/s1 |
InChIKey | FZFJUKOAGOAQFB-NRFANRHFSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | C[C@]1(Cn2cccc2C(=N1)N)c3cc(ccc3F)NC(=O)c4ccc(cn4)C#N | CACTVS 3.385 | C[C]1(Cn2cccc2C(=N1)N)c3cc(NC(=O)c4ccc(cn4)C#N)ccc3F | CACTVS 3.385 | C[C@]1(Cn2cccc2C(=N1)N)c3cc(NC(=O)c4ccc(cn4)C#N)ccc3F | OpenEye OEToolkits 2.0.7 | CC1(Cn2cccc2C(=N1)N)c3cc(ccc3F)NC(=O)c4ccc(cn4)C#N | ACDLabs 12.01 | C(#N)c1cnc(cc1)C(Nc2cc(c(F)cc2)C4(N=C(c3cccn3C4)N)C)=O |
|
Formula | C21 H17 F N6 O |
Name | N-{3-[(3R)-1-amino-3-methyl-3,4-dihydropyrrolo[1,2-a]pyrazin-3-yl]-4-fluorophenyl}-5-cyanopyridine-2-carboxamide |
ChEMBL | CHEMBL3261075 |
DrugBank | |
ZINC | ZINC000169335912
|
PDB chain | 6od6 Chain B Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.4.23.46: memapsin 2. |
|
|
|