Structure of PDB 6das Chain B Binding Site BS01 |
|
|
Ligand ID | G2D |
InChI | InChI=1S/C24H25N3O2/c1-15-5-6-18(13-22(15)29-2)24(28)26-20-10-9-16-7-8-17(12-19(16)20)21-14-27-11-3-4-23(27)25-21/h5-8,12-14,20H,3-4,9-11H2,1-2H3,(H,26,28)/t20-/m1/s1 |
InChIKey | PHINNLAJTUGZSZ-HXUWFJFHSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | COc1cc(ccc1C)C(=O)N[C@@H]2CCc3ccc(cc23)c4cn5CCCc5n4 | OpenEye OEToolkits 2.0.6 | Cc1ccc(cc1OC)C(=O)NC2CCc3c2cc(cc3)c4cn5c(n4)CCC5 | ACDLabs 12.01 | c5c(c(cc(C(NC4c3c(ccc(c2cn1c(CCC1)n2)c3)CC4)=O)c5)OC)C | OpenEye OEToolkits 2.0.6 | Cc1ccc(cc1OC)C(=O)N[C@@H]2CCc3c2cc(cc3)c4cn5c(n4)CCC5 | CACTVS 3.385 | COc1cc(ccc1C)C(=O)N[CH]2CCc3ccc(cc23)c4cn5CCCc5n4 |
|
Formula | C24 H25 N3 O2 |
Name | N-[(1R)-6-(6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-2-yl)-2,3-dihydro-1H-inden-1-yl]-3-methoxy-4-methylbenzamide |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6das Chain B Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|