Structure of PDB 6vur Chain A Binding Site BS01 |
|
|
Ligand ID | ROG |
InChI | InChI=1S/C17H24N4S2/c1-21-8-4-5-11(9-21)10-22-17-19-15(18)14-12-6-2-3-7-13(12)23-16(14)20-17/h11H,2-10H2,1H3,(H2,18,19,20)/t11-/m0/s1 |
InChIKey | JTFCZCDNOWUZNN-NSHDSACASA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CN1CCC[CH](CSc2nc(N)c3c(sc4CCCCc34)n2)C1 | OpenEye OEToolkits 2.0.7 | CN1CCCC(C1)CSc2nc(c3c4c(sc3n2)CCCC4)N | OpenEye OEToolkits 2.0.7 | CN1CCC[C@@H](C1)CSc2nc(c3c4c(sc3n2)CCCC4)N | CACTVS 3.385 | CN1CCC[C@H](CSc2nc(N)c3c(sc4CCCCc34)n2)C1 | ACDLabs 12.01 | C1CCC(CN1C)CSc2nc(c3c(n2)sc4c3CCCC4)N |
|
Formula | C17 H24 N4 S2 |
Name | 2-({[(3S)-1-methylpiperidin-3-yl]methyl}sulfanyl)-5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidin-4-amine |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6vur Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
Biological Process |
GO:0030649 |
aminoglycoside antibiotic catabolic process |
GO:0033661 |
effector-mediated defense to host-produced reactive oxygen species |
GO:0034054 |
symbiont-mediated suppression of host defense-related programmed cell death |
GO:0046677 |
response to antibiotic |
GO:0051701 |
biological process involved in interaction with host |
GO:0052032 |
symbiont-mediated perturbation of host inflammatory response |
GO:0052040 |
symbiont-mediated perturbation of host programmed cell death |
GO:0052167 |
symbiont-mediated perturbation of host innate immune response |
|
|