Structure of PDB 5zkc Chain A Binding Site BS01 |
|
|
Ligand ID | 3C0 |
InChI | InChI=1S/C18H24NO4/c1-19(2)14-8-12(9-15(19)17-16(14)23-17)22-18(21)13(10-20)11-6-4-3-5-7-11/h3-7,12-17,20H,8-10H2,1-2H3/q+1/t12-,13-,14-,15+,16-,17+/m1/s1 |
InChIKey | LZCOQTDXKCNBEE-IKIFYQGPSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | C[N+]1(C2CC(CC1C3C2O3)OC(=O)C(CO)c4ccccc4)C | OpenEye OEToolkits 1.9.2 | C[N+]1([C@@H]2CC(C[C@H]1[C@H]3[C@@H]2O3)OC(=O)[C@H](CO)c4ccccc4)C | CACTVS 3.385 | C[N+]1(C)[CH]2CC(C[CH]1[CH]3O[CH]23)OC(=O)[CH](CO)c4ccccc4 | CACTVS 3.385 | C[N+]1(C)[C@@H]2CC(C[C@H]1[C@@H]3O[C@H]23)OC(=O)[C@H](CO)c4ccccc4 | ACDLabs 12.01 | O=C(OC1CC2[N+](C(C1)C3OC23)(C)C)C(c4ccccc4)CO |
|
Formula | C18 H24 N O4 |
Name | N-methyl scopolamine; (1R,2R,4S,5S,7s)-7-{[(2S)-3-hydroxy-2-phenylpropanoyl]oxy}-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.0~2,4~]nonane |
ChEMBL | CHEMBL376897 |
DrugBank | DB11315 |
ZINC | ZINC000100047524
|
PDB chain | 5zkc Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|