Structure of PDB 5ntp Chain A Binding Site BS01 |
|
|
Ligand ID | 98E |
InChI | InChI=1S/C25H32ClN5O2/c1-16-14-30(8-9-31(16)25(33)19-6-4-5-7-19)15-20-10-22(26)11-23(17(20)2)29-24(32)21-12-27-18(3)28-13-21/h10-13,16,19H,4-9,14-15H2,1-3H3,(H,29,32)/t16-/m0/s1 |
InChIKey | HAXBJJXPLDXDIL-INIZCTEOSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | C[C@H]1CN(CCN1C(=O)C2CCCC2)Cc3cc(Cl)cc(NC(=O)c4cnc(C)nc4)c3C | OpenEye OEToolkits 2.0.6 | Cc1c(cc(cc1NC(=O)c2cnc(nc2)C)Cl)CN3CCN(C(C3)C)C(=O)C4CCCC4 | CACTVS 3.385 | C[CH]1CN(CCN1C(=O)C2CCCC2)Cc3cc(Cl)cc(NC(=O)c4cnc(C)nc4)c3C | OpenEye OEToolkits 2.0.6 | Cc1c(cc(cc1NC(=O)c2cnc(nc2)C)Cl)CN3CCN([C@H](C3)C)C(=O)C4CCCC4 |
|
Formula | C25 H32 Cl N5 O2 |
Name | (S)-N-(5-chloro-3-((4-(cyclopentanecarbonyl)-3-methylpiperazin-1-yl)methyl)-2-methylphenyl)-2-methylpyrimidine-5-carboxamide |
ChEMBL | CHEMBL5205088 |
DrugBank | |
ZINC |
|
PDB chain | 5ntp Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|