Structure of PDB 5f1v Chain A Binding Site BS01 |
|
|
Ligand ID | 3VN |
InChI | InChI=1S/C14H30N4O4/c15-9-3-1-5-13(17,11(19)20)7-8-14(18,12(21)22)6-2-4-10-16/h1-10,15-18H2,(H,19,20)(H,21,22)/t13-,14-/m1/s1 |
InChIKey | XYUHPPVEDOOPDE-ZIAGYGMSSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C(O)C(N)(CCC(N)(C(=O)O)CCCCN)CCCCN | CACTVS 3.385 | NCCCC[C@@](N)(CC[C@](N)(CCCCN)C(O)=O)C(O)=O | OpenEye OEToolkits 1.7.6 | C(CCN)CC(CCC(CCCCN)(C(=O)O)N)(C(=O)O)N | CACTVS 3.385 | NCCCC[C](N)(CC[C](N)(CCCCN)C(O)=O)C(O)=O | OpenEye OEToolkits 1.7.6 | C(CCN)C[C@@](CC[C@](CCCCN)(C(=O)O)N)(C(=O)O)N |
|
Formula | C14 H30 N4 O4 |
Name | (2R,5R)-2,5-diamino-2,5-bis(4-aminobutyl)hexanedioic acid; bis-Lysine |
ChEMBL | CHEMBL4516644 |
DrugBank | |
ZINC | ZINC000263621249
|
PDB chain | 5f1v Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|