Structure of PDB 4rxe Chain A Binding Site BS01 |
|
|
Ligand ID | 3YQ |
InChI | InChI=1S/C7H12N2O6P2/c1-5-3-2-4-8-6(5)9-7(16(10,11)12)17(13,14)15/h2-4,7H,1H3,(H,8,9)(H2,10,11,12)(H2,13,14,15) |
InChIKey | NAIJOBGUXRHQJW-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Cc1cccnc1NC([P](O)(O)=O)[P](O)(O)=O | ACDLabs 12.01 | O=P(O)(O)C(Nc1ncccc1C)P(=O)(O)O | OpenEye OEToolkits 1.7.6 | Cc1cccnc1NC(P(=O)(O)O)P(=O)(O)O |
|
Formula | C7 H12 N2 O6 P2 |
Name | {[(3-methylpyridin-2-yl)amino]methanediyl}bis(phosphonic acid) |
ChEMBL | CHEMBL55140 |
DrugBank | |
ZINC | ZINC000013473668
|
PDB chain | 4rxe Chain A Residue 3001
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|